C15H27NO4S — CID 91364609
4-[3-methyl-5-[(2-methylpropan-2-yl)oxy]hexa-1,5-dienyl]sulfonylmorpholine (PubChem CID 91364609) has the molecular formula C15H27NO4S and a molecular weight of 317.45 g/mol. Its IUPAC name is 4-[3-methyl-5-[(2-methylpropan-2-yl)oxy]hexa-1,5-dienyl]sulfonylmorpholine.
| Compound Name | 4-[3-methyl-5-[(2-methylpropan-2-yl)oxy]hexa-1,5-dienyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 91364609 |
| Molecular Formula | C15H27NO4S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 4-[3-methyl-5-[(2-methylpropan-2-yl)oxy]hexa-1,5-dienyl]sulfonylmorpholine |
| SMILES | C=C(CC(C)C=CS(=O)(=O)N1CCOCC1)OC(C)(C)C |
| InChI | InChI=1S/C15H27NO4S/c1-13(12-14(2)20-15(3,4)5)6-11-21(17,18)16-7-9-19-10-8-16/h6,11,13H,2,7-10,12H2,1,3-5H3 |
| InChIKey | IPTKQJWYMYBVRU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|