C11H24NO3P — CID 163490188
4-[2,3-dimethylbutan-2-yl(methoxy)phosphoryl]morpholine (PubChem CID 163490188) has the molecular formula C11H24NO3P and a molecular weight of 249.29 g/mol. Its IUPAC name is 4-[2,3-dimethylbutan-2-yl(methoxy)phosphoryl]morpholine.
| Compound Name | 4-[2,3-dimethylbutan-2-yl(methoxy)phosphoryl]morpholine |
|---|---|
| PubChem CID | 163490188 |
| Molecular Formula | C11H24NO3P |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 4-[2,3-dimethylbutan-2-yl(methoxy)phosphoryl]morpholine |
| SMILES | COP(=O)(N1CCOCC1)C(C)(C)C(C)C |
| InChI | InChI=1S/C11H24NO3P/c1-10(2)11(3,4)16(13,14-5)12-6-8-15-9-7-12/h10H,6-9H2,1-5H3 |
| InChIKey | CLYBFIPZDIDIAC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|