C16H27N2O4PS — CID 22758972
4-[4-tert-butyl-2-(dimethoxyphosphorylamino)sulfanylphenyl]morpholine (PubChem CID 22758972) has the molecular formula C16H27N2O4PS and a molecular weight of 374.44 g/mol. Its IUPAC name is 4-[4-tert-butyl-2-(dimethoxyphosphorylamino)sulfanylphenyl]morpholine.
| Compound Name | 4-[4-tert-butyl-2-(dimethoxyphosphorylamino)sulfanylphenyl]morpholine |
|---|---|
| PubChem CID | 22758972 |
| Molecular Formula | C16H27N2O4PS |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 4-[4-tert-butyl-2-(dimethoxyphosphorylamino)sulfanylphenyl]morpholine |
| SMILES | COP(=O)(NSc1cc(C(C)(C)C)ccc1N1CCOCC1)OC |
| InChI | InChI=1S/C16H27N2O4PS/c1-16(2,3)13-6-7-14(18-8-10-22-11-9-18)15(12-13)24-17-23(19,20-4)21-5/h6-7,12H,8-11H2,1-5H3,(H,17,19) |
| InChIKey | QUMFRWKPNGQTLE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|