C16H27N2O3PS — CID 70628951
5-tert-butyl-N-dimethoxyphosphinothioyl-2-morpholin-4-ylaniline (PubChem CID 70628951) has the molecular formula C16H27N2O3PS and a molecular weight of 358.44 g/mol. Its IUPAC name is 5-tert-butyl-N-dimethoxyphosphinothioyl-2-morpholin-4-ylaniline.
| Compound Name | 5-tert-butyl-N-dimethoxyphosphinothioyl-2-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 70628951 |
| Molecular Formula | C16H27N2O3PS |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 5-tert-butyl-N-dimethoxyphosphinothioyl-2-morpholin-4-ylaniline |
| SMILES | COP(=S)(Nc1cc(C(C)(C)C)ccc1N1CCOCC1)OC |
| InChI | InChI=1S/C16H27N2O3PS/c1-16(2,3)13-6-7-15(18-8-10-21-11-9-18)14(12-13)17-22(23,19-4)20-5/h6-7,12H,8-11H2,1-5H3,(H,17,23) |
| InChIKey | WXJKOQDMXCZYDC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|