C11H17NO5 — CID 144653695
(Z,4S)-4-methyl-5-(morpholine-4-carbonyloxy)pent-2-enoic acid (PubChem CID 144653695) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is (Z,4S)-4-methyl-5-(morpholine-4-carbonyloxy)pent-2-enoic acid.
| Compound Name | (Z,4S)-4-methyl-5-(morpholine-4-carbonyloxy)pent-2-enoic acid |
|---|---|
| PubChem CID | 144653695 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | (Z,4S)-4-methyl-5-(morpholine-4-carbonyloxy)pent-2-enoic acid |
| SMILES | C[C@@H](/C=C\C(=O)O)COC(=O)N1CCOCC1 |
| InChI | InChI=1S/C11H17NO5/c1-9(2-3-10(13)14)8-17-11(15)12-4-6-16-7-5-12/h2-3,9H,4-8H2,1H3,(H,13,14)/b3-2-/t9-/m0/s1 |
| InChIKey | GPUSPLRYGWAQON-XADBCAIWSA-N |
| XLogP | 0.73 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|