C19H35NO3 — CID 177398558
tert-butyl (E,3S)-3-ethyl-6,6-dimethyl-5-morpholin-4-ylhept-4-enoate (PubChem CID 177398558) has the molecular formula C19H35NO3 and a molecular weight of 325.49 g/mol. Its IUPAC name is tert-butyl (E,3S)-3-ethyl-6,6-dimethyl-5-morpholin-4-ylhept-4-enoate.
| Compound Name | tert-butyl (E,3S)-3-ethyl-6,6-dimethyl-5-morpholin-4-ylhept-4-enoate |
|---|---|
| PubChem CID | 177398558 |
| Molecular Formula | C19H35NO3 |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 325.26 |
| IUPAC Name | tert-butyl (E,3S)-3-ethyl-6,6-dimethyl-5-morpholin-4-ylhept-4-enoate |
| SMILES | CC[C@H](/C=C(/N1CCOCC1)C(C)(C)C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H35NO3/c1-8-15(14-17(21)23-19(5,6)7)13-16(18(2,3)4)20-9-11-22-12-10-20/h13,15H,8-12,14H2,1-7H3/b16-13+/t15-/m1/s1 |
| InChIKey | HYEYJALUQYRBQZ-WTNDLDAUSA-N |
| XLogP | 4.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |