C9H18FNO3 — CID 88580512
tert-butyl (3S)-3-amino-5-fluoro-4-hydroxypentanoate (PubChem CID 88580512) has the molecular formula C9H18FNO3 and a molecular weight of 207.24 g/mol. Its IUPAC name is tert-butyl (3S)-3-amino-5-fluoro-4-hydroxypentanoate.
| Compound Name | tert-butyl (3S)-3-amino-5-fluoro-4-hydroxypentanoate |
|---|---|
| PubChem CID | 88580512 |
| Molecular Formula | C9H18FNO3 |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | tert-butyl (3S)-3-amino-5-fluoro-4-hydroxypentanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](N)C(O)CF |
| InChI | InChI=1S/C9H18FNO3/c1-9(2,3)14-8(13)4-6(11)7(12)5-10/h6-7,12H,4-5,11H2,1-3H3/t6-,7?/m0/s1 |
| InChIKey | GAOCYGMWQJTKPG-PKPIPKONSA-N |
| XLogP | 0.38 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |