C14H22N2O4 — CID 174656656
tert-butyl 3-amino-4-hydroxy-5-pyridin-2-yloxypentanoate (PubChem CID 174656656) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is tert-butyl 3-amino-4-hydroxy-5-pyridin-2-yloxypentanoate.
| Compound Name | tert-butyl 3-amino-4-hydroxy-5-pyridin-2-yloxypentanoate |
|---|---|
| PubChem CID | 174656656 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | tert-butyl 3-amino-4-hydroxy-5-pyridin-2-yloxypentanoate |
| SMILES | CC(C)(C)OC(=O)CC(N)C(O)COc1ccccn1 |
| InChI | InChI=1S/C14H22N2O4/c1-14(2,3)20-13(18)8-10(15)11(17)9-19-12-6-4-5-7-16-12/h4-7,10-11,17H,8-9,15H2,1-3H3 |
| InChIKey | HRCHXHCWJAEXAA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |