C7H19NO4 — CID 142904970
acetaldehyde;2-(hydroxymethyl)propane-1,3-diol;methanamine (PubChem CID 142904970) has the molecular formula C7H19NO4 and a molecular weight of 181.23 g/mol. Its IUPAC name is acetaldehyde;2-(hydroxymethyl)propane-1,3-diol;methanamine.
| Compound Name | acetaldehyde;2-(hydroxymethyl)propane-1,3-diol;methanamine |
|---|---|
| PubChem CID | 142904970 |
| Molecular Formula | C7H19NO4 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | acetaldehyde;2-(hydroxymethyl)propane-1,3-diol;methanamine |
| SMILES | CC=O.CN.OCC(CO)CO |
| InChI | InChI=1S/C4H10O3.C2H4O.CH5N/c5-1-4(2-6)3-7;1-2-3;1-2/h4-7H,1-3H2;2H,1H3;2H2,1H3 |
| InChIKey | YSFBWYGTWUGFGD-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|