C7H15NO2 — CID 131247473
(2S)-3-[[(E)-but-2-enyl]amino]propane-1,2-diol (PubChem CID 131247473) has the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. Its IUPAC name is (2S)-3-[[(E)-but-2-enyl]amino]propane-1,2-diol.
| Compound Name | (2S)-3-[[(E)-but-2-enyl]amino]propane-1,2-diol |
|---|---|
| PubChem CID | 131247473 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | (2S)-3-[[(E)-but-2-enyl]amino]propane-1,2-diol |
| SMILES | C/C=C/CNC[C@H](O)CO |
| InChI | InChI=1S/C7H15NO2/c1-2-3-4-8-5-7(10)6-9/h2-3,7-10H,4-6H2,1H3/b3-2+/t7-/m0/s1 |
| InChIKey | ILSGDKOBSIOUOE-AIYRYJHASA-N |
| XLogP | -0.49 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|