C11H23NO2 — CID 142202246
ethane;3-(prop-2-enylamino)propane-1,2-diol;prop-1-yne (PubChem CID 142202246) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is ethane;3-(prop-2-enylamino)propane-1,2-diol;prop-1-yne.
| Compound Name | ethane;3-(prop-2-enylamino)propane-1,2-diol;prop-1-yne |
|---|---|
| PubChem CID | 142202246 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | ethane;3-(prop-2-enylamino)propane-1,2-diol;prop-1-yne |
| SMILES | C#CC.C=CCNCC(O)CO.CC |
| InChI | InChI=1S/C6H13NO2.C3H4.C2H6/c1-2-3-7-4-6(9)5-8;1-3-2;1-2/h2,6-9H,1,3-5H2;1H,2H3;1-2H3 |
| InChIKey | APYDUJZGIWHHHP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|