C6H12O4 — CID 88508901
(2R,5R)-hex-3-ene-1,2,5,6-tetrol (PubChem CID 88508901) has the molecular formula C6H12O4 and a molecular weight of 148.16 g/mol. Its IUPAC name is (2R,5R)-hex-3-ene-1,2,5,6-tetrol.
| Compound Name | (2R,5R)-hex-3-ene-1,2,5,6-tetrol |
|---|---|
| PubChem CID | 88508901 |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | (2R,5R)-hex-3-ene-1,2,5,6-tetrol |
| SMILES | OC[C@H](O)C=C[C@@H](O)CO |
| InChI | InChI=1S/C6H12O4/c7-3-5(9)1-2-6(10)4-8/h1-2,5-10H,3-4H2/t5-,6-/m1/s1 |
| InChIKey | LFUPTFHBGBCXDZ-PHDIDXHHSA-N |
| XLogP | -1.75 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|