C13H16O4 — CID 132506000
(3Z,5S,6R,11E)-trideca-3,11-dien-7,9-diyne-1,2,5,6-tetrol (PubChem CID 132506000) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (3Z,5S,6R,11E)-trideca-3,11-dien-7,9-diyne-1,2,5,6-tetrol.
| Compound Name | (3Z,5S,6R,11E)-trideca-3,11-dien-7,9-diyne-1,2,5,6-tetrol |
|---|---|
| PubChem CID | 132506000 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (3Z,5S,6R,11E)-trideca-3,11-dien-7,9-diyne-1,2,5,6-tetrol |
| SMILES | C/C=C/C#CC#C[C@@H](O)[C@@H](O)/C=C\C(O)CO |
| InChI | InChI=1S/C13H16O4/c1-2-3-4-5-6-7-12(16)13(17)9-8-11(15)10-14/h2-3,8-9,11-17H,10H2,1H3/b3-2+,9-8-/t11?,12-,13+/m1/s1 |
| InChIKey | LOSDVGUAIPSNJO-ITXWOOGRSA-N |
| XLogP | -0.80 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|