C17H18O3 — CID 162944363
[(2R,3E,11E)-1-hydroxytrideca-3,11-dien-5,7,9-triyn-2-yl] 2-methylpropanoate (PubChem CID 162944363) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is [(2R,3E,11E)-1-hydroxytrideca-3,11-dien-5,7,9-triyn-2-yl] 2-methylpropanoate.
| Compound Name | [(2R,3E,11E)-1-hydroxytrideca-3,11-dien-5,7,9-triyn-2-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 162944363 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | [(2R,3E,11E)-1-hydroxytrideca-3,11-dien-5,7,9-triyn-2-yl] 2-methylpropanoate |
| SMILES | C/C=C/C#CC#CC#C/C=C/[C@H](CO)OC(=O)C(C)C |
| InChI | InChI=1S/C17H18O3/c1-4-5-6-7-8-9-10-11-12-13-16(14-18)20-17(19)15(2)3/h4-5,12-13,15-16,18H,14H2,1-3H3/b5-4+,13-12+/t16-/m1/s1 |
| InChIKey | RFSVINRTVSTZCD-OAAGCRRHSA-N |
| XLogP | 1.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|