C18H22O4 — CID 162971088
[(3R,6E,12E)-3-acetyloxytetradeca-6,12-dien-8,10-diynyl] acetate (PubChem CID 162971088) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is [(3R,6E,12E)-3-acetyloxytetradeca-6,12-dien-8,10-diynyl] acetate.
| Compound Name | [(3R,6E,12E)-3-acetyloxytetradeca-6,12-dien-8,10-diynyl] acetate |
|---|---|
| PubChem CID | 162971088 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [(3R,6E,12E)-3-acetyloxytetradeca-6,12-dien-8,10-diynyl] acetate |
| SMILES | C/C=C/C#CC#C/C=C/CC[C@H](CCOC(C)=O)OC(C)=O |
| InChI | InChI=1S/C18H22O4/c1-4-5-6-7-8-9-10-11-12-13-18(22-17(3)20)14-15-21-16(2)19/h4-5,10-11,18H,12-15H2,1-3H3/b5-4+,11-10+/t18-/m1/s1 |
| InChIKey | QQRFFZAYQSFFQP-DFCFZKSTSA-N |
| XLogP | 2.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|