C15H16O2 — CID 90470855
[(2E,8Z)-deca-2,8-dien-4,6-diynyl] 3-methylbut-2-enoate (PubChem CID 90470855) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is [(2E,8Z)-deca-2,8-dien-4,6-diynyl] 3-methylbut-2-enoate.
| Compound Name | [(2E,8Z)-deca-2,8-dien-4,6-diynyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 90470855 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | [(2E,8Z)-deca-2,8-dien-4,6-diynyl] 3-methylbut-2-enoate |
| SMILES | C/C=C\C#CC#C/C=C/COC(=O)C=C(C)C |
| InChI | InChI=1S/C15H16O2/c1-4-5-6-7-8-9-10-11-12-17-15(16)13-14(2)3/h4-5,10-11,13H,12H2,1-3H3/b5-4-,11-10+ |
| InChIKey | OXMXWBHUENSAIH-JWPKELMXSA-N |
| XLogP | 2.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|