C16H18O3 — CID 162896969
methyl 10-(2-methylbut-2-enoxy)deca-2,8-dien-4,6-diynoate (PubChem CID 162896969) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is methyl 10-(2-methylbut-2-enoxy)deca-2,8-dien-4,6-diynoate.
| Compound Name | methyl 10-(2-methylbut-2-enoxy)deca-2,8-dien-4,6-diynoate |
|---|---|
| PubChem CID | 162896969 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | methyl 10-(2-methylbut-2-enoxy)deca-2,8-dien-4,6-diynoate |
| SMILES | CC=C(C)COCC=CC#CC#CC=CC(=O)OC |
| InChI | InChI=1S/C16H18O3/c1-4-15(2)14-19-13-11-9-7-5-6-8-10-12-16(17)18-3/h4,9-12H,13-14H2,1-3H3 |
| InChIKey | UATXVVCNAWZZLB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|