About pent-3-enyl acetate
pent-3-enyl acetate (PubChem CID 54089070) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is pent-3-enyl acetate.
Molecular Properties
| Compound Name | pent-3-enyl acetate |
| PubChem CID | 54089070 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | pent-3-enyl acetate |
| SMILES | CC=CCCOC(C)=O |
| InChI | InChI=1S/C7H12O2/c1-3-4-5-6-9-7(2)8/h3-4H,5-6H2,1-2H3 |
| InChIKey | MSOPZDSMYQRTCD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pent-3-enyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-3-enyl acetate?
The IUPAC name of pent-3-enyl acetate (CID 54089070) is pent-3-enyl acetate.
What is the SMILES notation for pent-3-enyl acetate?
The canonical SMILES for pent-3-enyl acetate is CC=CCCOC(C)=O.
What is the InChIKey of pent-3-enyl acetate?
The InChIKey is MSOPZDSMYQRTCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2/c1-3-4-5-6-9-7(2)8/h3-4H,5-6H2,1-2H3.
What are the key properties of pent-3-enyl acetate?
pent-3-enyl acetate has a molecular weight of 128.17 g/mol, XLogP of 1.52, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pent-3-enyl acetate is sourced from PubChem (CID 54089070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).