About pent-3-enyl hydrogen carbonate
pent-3-enyl hydrogen carbonate (PubChem CID 54464820) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is pent-3-enyl hydrogen carbonate.
Molecular Properties
| Compound Name | pent-3-enyl hydrogen carbonate |
| PubChem CID | 54464820 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | pent-3-enyl hydrogen carbonate |
| SMILES | CC=CCCOC(=O)O |
| InChI | InChI=1S/C6H10O3/c1-2-3-4-5-9-6(7)8/h2-3H,4-5H2,1H3,(H,7,8) |
| InChIKey | XECBJKQYTAMQOI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pent-3-enyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-3-enyl hydrogen carbonate?
The IUPAC name of pent-3-enyl hydrogen carbonate (CID 54464820) is pent-3-enyl hydrogen carbonate.
What is the SMILES notation for pent-3-enyl hydrogen carbonate?
The canonical SMILES for pent-3-enyl hydrogen carbonate is CC=CCCOC(=O)O.
What is the InChIKey of pent-3-enyl hydrogen carbonate?
The InChIKey is XECBJKQYTAMQOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3/c1-2-3-4-5-9-6(7)8/h2-3H,4-5H2,1H3,(H,7,8).
What are the key properties of pent-3-enyl hydrogen carbonate?
pent-3-enyl hydrogen carbonate has a molecular weight of 130.14 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pent-3-enyl hydrogen carbonate is sourced from PubChem (CID 54464820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).