C8H14O3 — CID 173348804
6-methylhepta-3,5-diene-1,2,5-triol (PubChem CID 173348804) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is 6-methylhepta-3,5-diene-1,2,5-triol.
| Compound Name | 6-methylhepta-3,5-diene-1,2,5-triol |
|---|---|
| PubChem CID | 173348804 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 6-methylhepta-3,5-diene-1,2,5-triol |
| SMILES | CC(C)=C(O)C=CC(O)CO |
| InChI | InChI=1S/C8H14O3/c1-6(2)8(11)4-3-7(10)5-9/h3-4,7,9-11H,5H2,1-2H3 |
| InChIKey | HHEXUVUOYCUQMH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|