C9H16O — CID 11007995
(3R,4S,5E)-2,4-dimethylhepta-1,5-dien-3-ol (PubChem CID 11007995) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is (3R,4S,5E)-2,4-dimethylhepta-1,5-dien-3-ol.
| Compound Name | (3R,4S,5E)-2,4-dimethylhepta-1,5-dien-3-ol |
|---|---|
| PubChem CID | 11007995 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (3R,4S,5E)-2,4-dimethylhepta-1,5-dien-3-ol |
| SMILES | C=C(C)[C@H](O)[C@@H](C)/C=C/C |
| InChI | InChI=1S/C9H16O/c1-5-6-8(4)9(10)7(2)3/h5-6,8-10H,2H2,1,3-4H3/b6-5+/t8-,9-/m0/s1 |
| InChIKey | UIRPBZZAPBWXIO-MUNZNRDXSA-N |
| XLogP | 2.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|