3-hydroxy-2,4-dimethylpent-4-enoic acid

C7H12O3 — CID 13152656

IUPAC3-hydroxy-2,4-dimethylpent-4-enoic acid
SMILESC=C(C)C(O)C(C)C(=O)O
InChIInChI=1S/C7H12O3/c1-4(2)6(8)5(3)7(9)10/h5-6,8H,1H2,2-3H3,(H,9,10)
InChIKeyUPOGRPPNKCXUTJ-UHFFFAOYSA-N
MW144.17 g/mol
LogP0.64
Rot. Bonds3

About 3-hydroxy-2,4-dimethylpent-4-enoic acid

3-hydroxy-2,4-dimethylpent-4-enoic acid (PubChem CID 13152656) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is 3-hydroxy-2,4-dimethylpent-4-enoic acid.

Molecular Properties

Compound Name3-hydroxy-2,4-dimethylpent-4-enoic acid
PubChem CID13152656
Molecular FormulaC7H12O3
Molecular Weight144.17 g/mol
Exact Mass144.08
IUPAC Name3-hydroxy-2,4-dimethylpent-4-enoic acid
SMILESC=C(C)C(O)C(C)C(=O)O
InChIInChI=1S/C7H12O3/c1-4(2)6(8)5(3)7(9)10/h5-6,8H,1H2,2-3H3,(H,9,10)
InChIKeyUPOGRPPNKCXUTJ-UHFFFAOYSA-N
XLogP0.64
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500144.17
LogP ≤ 50.64
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 3-hydroxy-2,4-dimethylpent-4-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-hydroxy-2,4-dimethylpent-4-enoic acid?
The IUPAC name of 3-hydroxy-2,4-dimethylpent-4-enoic acid (CID 13152656) is 3-hydroxy-2,4-dimethylpent-4-enoic acid.
What is the SMILES notation for 3-hydroxy-2,4-dimethylpent-4-enoic acid?
The canonical SMILES for 3-hydroxy-2,4-dimethylpent-4-enoic acid is C=C(C)C(O)C(C)C(=O)O.
What is the InChIKey of 3-hydroxy-2,4-dimethylpent-4-enoic acid?
The InChIKey is UPOGRPPNKCXUTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-4(2)6(8)5(3)7(9)10/h5-6,8H,1H2,2-3H3,(H,9,10).
What are the key properties of 3-hydroxy-2,4-dimethylpent-4-enoic acid?
3-hydroxy-2,4-dimethylpent-4-enoic acid has a molecular weight of 144.17 g/mol, XLogP of 0.64, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2,4-dimethylpent-4-enoic acid is sourced from PubChem (CID 13152656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).