C13H22Br2O2 — CID 102013277
(2S,3S)-7-bromo-5-(2-bromoethyl)-2-methyl-3-prop-1-en-2-ylheptanoic acid (PubChem CID 102013277) has the molecular formula C13H22Br2O2 and a molecular weight of 370.13 g/mol. Its IUPAC name is (2S,3S)-7-bromo-5-(2-bromoethyl)-2-methyl-3-prop-1-en-2-ylheptanoic acid.
| Compound Name | (2S,3S)-7-bromo-5-(2-bromoethyl)-2-methyl-3-prop-1-en-2-ylheptanoic acid |
|---|---|
| PubChem CID | 102013277 |
| Molecular Formula | C13H22Br2O2 |
| Molecular Weight | 370.13 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | (2S,3S)-7-bromo-5-(2-bromoethyl)-2-methyl-3-prop-1-en-2-ylheptanoic acid |
| SMILES | C=C(C)[C@@H](CC(CCBr)CCBr)[C@H](C)C(=O)O |
| InChI | InChI=1S/C13H22Br2O2/c1-9(2)12(10(3)13(16)17)8-11(4-6-14)5-7-15/h10-12H,1,4-8H2,2-3H3,(H,16,17)/t10-,12+/m0/s1 |
| InChIKey | FAKBRZDHTLLSIQ-CMPLNLGQSA-N |
| XLogP | 4.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.13 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|