C9H19BrO6 — CID 53446872
acetic acid;2-(2-bromoethyl)propane-1,3-diol (PubChem CID 53446872) has the molecular formula C9H19BrO6 and a molecular weight of 303.15 g/mol. Its IUPAC name is acetic acid;2-(2-bromoethyl)propane-1,3-diol.
| Compound Name | acetic acid;2-(2-bromoethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 53446872 |
| Molecular Formula | C9H19BrO6 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | acetic acid;2-(2-bromoethyl)propane-1,3-diol |
| SMILES | CC(=O)O.CC(=O)O.OCC(CO)CCBr |
| InChI | InChI=1S/C5H11BrO2.2C2H4O2/c6-2-1-5(3-7)4-8;2*1-2(3)4/h5,7-8H,1-4H2;2*1H3,(H,3,4) |
| InChIKey | NDYIICZEYKAHOK-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|