About (4-cyano-3-methylbutyl) formate
(4-cyano-3-methylbutyl) formate (PubChem CID 88524019) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is (4-cyano-3-methylbutyl) formate.
Molecular Properties
| Compound Name | (4-cyano-3-methylbutyl) formate |
| PubChem CID | 88524019 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (4-cyano-3-methylbutyl) formate |
| SMILES | CC(CC#N)CCOC=O |
| InChI | InChI=1S/C7H11NO2/c1-7(2-4-8)3-5-10-6-9/h6-7H,2-3,5H2,1H3 |
| InChIKey | JDCNVRSERHTIRQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-cyano-3-methylbutyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyano-3-methylbutyl) formate?
The IUPAC name of (4-cyano-3-methylbutyl) formate (CID 88524019) is (4-cyano-3-methylbutyl) formate.
What is the SMILES notation for (4-cyano-3-methylbutyl) formate?
The canonical SMILES for (4-cyano-3-methylbutyl) formate is CC(CC#N)CCOC=O.
What is the InChIKey of (4-cyano-3-methylbutyl) formate?
The InChIKey is JDCNVRSERHTIRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-7(2-4-8)3-5-10-6-9/h6-7H,2-3,5H2,1H3.
What are the key properties of (4-cyano-3-methylbutyl) formate?
(4-cyano-3-methylbutyl) formate has a molecular weight of 141.17 g/mol, XLogP of 1.10, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyano-3-methylbutyl) formate is sourced from PubChem (CID 88524019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).