C16H20N6O6 — CID 159033725
2-[bis(cyanomethyl)amino]-4-formyloxybutanoic acid;2-[bis(cyanomethyl)amino]propanoic acid (PubChem CID 159033725) has the molecular formula C16H20N6O6 and a molecular weight of 392.37 g/mol. Its IUPAC name is 2-[bis(cyanomethyl)amino]-4-formyloxybutanoic acid;2-[bis(cyanomethyl)amino]propanoic acid.
| Compound Name | 2-[bis(cyanomethyl)amino]-4-formyloxybutanoic acid;2-[bis(cyanomethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 159033725 |
| Molecular Formula | C16H20N6O6 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-[bis(cyanomethyl)amino]-4-formyloxybutanoic acid;2-[bis(cyanomethyl)amino]propanoic acid |
| SMILES | CC(C(=O)O)N(CC#N)CC#N.N#CCN(CC#N)C(CCOC=O)C(=O)O |
| InChI | InChI=1S/C9H11N3O4.C7H9N3O2/c10-2-4-12(5-3-11)8(9(14)15)1-6-16-7-13;1-6(7(11)12)10(4-2-8)5-3-9/h7-8H,1,4-6H2,(H,14,15);6H,4-5H2,1H3,(H,11,12) |
| InChIKey | JVEVVOOFUSETSF-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 202.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|