About 3-methylheptanedinitrile
3-methylheptanedinitrile (PubChem CID 91621031) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 3-methylheptanedinitrile.
Molecular Properties
| Compound Name | 3-methylheptanedinitrile |
| PubChem CID | 91621031 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 3-methylheptanedinitrile |
| SMILES | CC(CC#N)CCCC#N |
| InChI | InChI=1S/C8H12N2/c1-8(5-7-10)4-2-3-6-9/h8H,2-5H2,1H3 |
| InChIKey | XWKHZCJVMBUPDS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methylheptanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylheptanedinitrile?
The IUPAC name of 3-methylheptanedinitrile (CID 91621031) is 3-methylheptanedinitrile.
What is the SMILES notation for 3-methylheptanedinitrile?
The canonical SMILES for 3-methylheptanedinitrile is CC(CC#N)CCCC#N.
What is the InChIKey of 3-methylheptanedinitrile?
The InChIKey is XWKHZCJVMBUPDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-8(5-7-10)4-2-3-6-9/h8H,2-5H2,1H3.
What are the key properties of 3-methylheptanedinitrile?
3-methylheptanedinitrile has a molecular weight of 136.20 g/mol, XLogP of 2.23, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylheptanedinitrile is sourced from PubChem (CID 91621031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).