About 3-(2-hydroxyethoxy)butyl formate
3-(2-hydroxyethoxy)butyl formate (PubChem CID 88906039) has the molecular formula C7H14O4
and a molecular weight of 162.18 g/mol. Its IUPAC name is 3-(2-hydroxyethoxy)butyl formate.
Molecular Properties
| Compound Name | 3-(2-hydroxyethoxy)butyl formate |
| PubChem CID | 88906039 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 3-(2-hydroxyethoxy)butyl formate |
| SMILES | CC(CCOC=O)OCCO |
| InChI | InChI=1S/C7H14O4/c1-7(11-5-3-8)2-4-10-6-9/h6-8H,2-5H2,1H3 |
| InChIKey | MVHYMWFIVSHHNY-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-hydroxyethoxy)butyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxyethoxy)butyl formate?
The IUPAC name of 3-(2-hydroxyethoxy)butyl formate (CID 88906039) is 3-(2-hydroxyethoxy)butyl formate.
What is the SMILES notation for 3-(2-hydroxyethoxy)butyl formate?
The canonical SMILES for 3-(2-hydroxyethoxy)butyl formate is CC(CCOC=O)OCCO.
What is the InChIKey of 3-(2-hydroxyethoxy)butyl formate?
The InChIKey is MVHYMWFIVSHHNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O4/c1-7(11-5-3-8)2-4-10-6-9/h6-8H,2-5H2,1H3.
What are the key properties of 3-(2-hydroxyethoxy)butyl formate?
3-(2-hydroxyethoxy)butyl formate has a molecular weight of 162.18 g/mol, XLogP of -0.05, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxyethoxy)butyl formate is sourced from PubChem (CID 88906039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).