C7H12Br2O3 — CID 151348061
2,4-dibromo-1,5-dimethoxypentan-3-one (PubChem CID 151348061) has the molecular formula C7H12Br2O3 and a molecular weight of 303.98 g/mol. Its IUPAC name is 2,4-dibromo-1,5-dimethoxypentan-3-one.
| Compound Name | 2,4-dibromo-1,5-dimethoxypentan-3-one |
|---|---|
| PubChem CID | 151348061 |
| Molecular Formula | C7H12Br2O3 |
| Molecular Weight | 303.98 g/mol |
| Exact Mass | 301.92 |
| IUPAC Name | 2,4-dibromo-1,5-dimethoxypentan-3-one |
| SMILES | COCC(Br)C(=O)C(Br)COC |
| InChI | InChI=1S/C7H12Br2O3/c1-11-3-5(8)7(10)6(9)4-12-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | OLWXHTGIBMTZNG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.98 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|