C8H21N3S — CID 134314000
(2S)-2-(methylamino)-3-[[(2S)-1-(methylamino)propan-2-yl]amino]propane-1-thiol (PubChem CID 134314000) has the molecular formula C8H21N3S and a molecular weight of 191.34 g/mol. Its IUPAC name is (2S)-2-(methylamino)-3-[[(2S)-1-(methylamino)propan-2-yl]amino]propane-1-thiol.
| Compound Name | (2S)-2-(methylamino)-3-[[(2S)-1-(methylamino)propan-2-yl]amino]propane-1-thiol |
|---|---|
| PubChem CID | 134314000 |
| Molecular Formula | C8H21N3S |
| Molecular Weight | 191.34 g/mol |
| Exact Mass | 191.15 |
| IUPAC Name | (2S)-2-(methylamino)-3-[[(2S)-1-(methylamino)propan-2-yl]amino]propane-1-thiol |
| SMILES | CNC[C@H](C)NC[C@@H](CS)NC |
| InChI | InChI=1S/C8H21N3S/c1-7(4-9-2)11-5-8(6-12)10-3/h7-12H,4-6H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | WCILEGOTZZMINK-YUMQZZPRSA-N |
| XLogP | -0.30 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.34 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|