C8H20N2S — CID 123274032
2-methyl-4,5-bis(methylamino)pentane-1-thiol (PubChem CID 123274032) has the molecular formula C8H20N2S and a molecular weight of 176.33 g/mol. Its IUPAC name is 2-methyl-4,5-bis(methylamino)pentane-1-thiol.
| Compound Name | 2-methyl-4,5-bis(methylamino)pentane-1-thiol |
|---|---|
| PubChem CID | 123274032 |
| Molecular Formula | C8H20N2S |
| Molecular Weight | 176.33 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2-methyl-4,5-bis(methylamino)pentane-1-thiol |
| SMILES | CNCC(CC(C)CS)NC |
| InChI | InChI=1S/C8H20N2S/c1-7(6-11)4-8(10-3)5-9-2/h7-11H,4-6H2,1-3H3 |
| InChIKey | QXRMURXRXKRSGV-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|