About 1-N,2-N-dimethylpentane-1,2-diamine;molecular hydrogen
1-N,2-N-dimethylpentane-1,2-diamine;molecular hydrogen (PubChem CID 171489835) has the molecular formula C7H22N2
and a molecular weight of 134.27 g/mol. Its IUPAC name is 1-N,2-N-dimethylpentane-1,2-diamine;molecular hydrogen.
Analyze 1-N,2-N-dimethylpentane-1,2-diamine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,2-N-dimethylpentane-1,2-diamine;molecular hydrogen?
The IUPAC name of 1-N,2-N-dimethylpentane-1,2-diamine;molecular hydrogen (CID 171489835) is 1-N,2-N-dimethylpentane-1,2-diamine;molecular hydrogen.
What is the SMILES notation for 1-N,2-N-dimethylpentane-1,2-diamine;molecular hydrogen?
The canonical SMILES for 1-N,2-N-dimethylpentane-1,2-diamine;molecular hydrogen is CCCC(CNC)NC.[H][H].[H][H].
What is the InChIKey of 1-N,2-N-dimethylpentane-1,2-diamine;molecular hydrogen?
The InChIKey is CHFMHVSRVNFEDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N2.2H2/c1-4-5-7(9-3)6-8-2;;/h7-9H,4-6H2,1-3H3;2*1H.
What are the key properties of 1-N,2-N-dimethylpentane-1,2-diamine;molecular hydrogen?
1-N,2-N-dimethylpentane-1,2-diamine;molecular hydrogen has a molecular weight of 134.27 g/mol, XLogP of 1.09, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,2-N-dimethylpentane-1,2-diamine;molecular hydrogen is sourced from PubChem (CID 171489835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).