About 5-(methylamino)octanoic acid
5-(methylamino)octanoic acid (PubChem CID 116953071) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is 5-(methylamino)octanoic acid.
Molecular Properties
| Compound Name | 5-(methylamino)octanoic acid |
| PubChem CID | 116953071 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 5-(methylamino)octanoic acid |
| SMILES | CCCC(CCCC(=O)O)NC |
| InChI | InChI=1S/C9H19NO2/c1-3-5-8(10-2)6-4-7-9(11)12/h8,10H,3-7H2,1-2H3,(H,11,12) |
| InChIKey | PMDUOWNZSNQXBV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(methylamino)octanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methylamino)octanoic acid?
The IUPAC name of 5-(methylamino)octanoic acid (CID 116953071) is 5-(methylamino)octanoic acid.
What is the SMILES notation for 5-(methylamino)octanoic acid?
The canonical SMILES for 5-(methylamino)octanoic acid is CCCC(CCCC(=O)O)NC.
What is the InChIKey of 5-(methylamino)octanoic acid?
The InChIKey is PMDUOWNZSNQXBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2/c1-3-5-8(10-2)6-4-7-9(11)12/h8,10H,3-7H2,1-2H3,(H,11,12).
What are the key properties of 5-(methylamino)octanoic acid?
5-(methylamino)octanoic acid has a molecular weight of 173.26 g/mol, XLogP of 1.63, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methylamino)octanoic acid is sourced from PubChem (CID 116953071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).