About docosanoic acid;N-methylmethanamine
docosanoic acid;N-methylmethanamine (PubChem CID 87854967) has the molecular formula C24H51NO2
and a molecular weight of 385.68 g/mol. Its IUPAC name is docosanoic acid;N-methylmethanamine.
Molecular Properties
| Compound Name | docosanoic acid;N-methylmethanamine |
| PubChem CID | 87854967 |
| Molecular Formula | C24H51NO2 |
| Molecular Weight | 385.68 g/mol |
| Exact Mass | 385.39 |
| IUPAC Name | docosanoic acid;N-methylmethanamine |
| SMILES | CCCCCCCCCCCCCCCCCCCCCC(=O)O.CNC |
| InChI | InChI=1S/C22H44O2.C2H7N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-3-2/h2-21H2,1H3,(H,23,24);3H,1-2H3 |
| InChIKey | BAZLSYABAYBCQU-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.68 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze docosanoic acid;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of docosanoic acid;N-methylmethanamine?
The IUPAC name of docosanoic acid;N-methylmethanamine (CID 87854967) is docosanoic acid;N-methylmethanamine.
What is the SMILES notation for docosanoic acid;N-methylmethanamine?
The canonical SMILES for docosanoic acid;N-methylmethanamine is CCCCCCCCCCCCCCCCCCCCCC(=O)O.CNC.
What is the InChIKey of docosanoic acid;N-methylmethanamine?
The InChIKey is BAZLSYABAYBCQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44O2.C2H7N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-3-2/h2-21H2,1H3,(H,23,24);3H,1-2H3.
What are the key properties of docosanoic acid;N-methylmethanamine?
docosanoic acid;N-methylmethanamine has a molecular weight of 385.68 g/mol, XLogP of 7.73, 20 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for docosanoic acid;N-methylmethanamine is sourced from PubChem (CID 87854967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).