About hexanoic acid;1-(methylamino)ethanol
hexanoic acid;1-(methylamino)ethanol (PubChem CID 173051508) has the molecular formula C9H21NO3
and a molecular weight of 191.27 g/mol. Its IUPAC name is hexanoic acid;1-(methylamino)ethanol.
Molecular Properties
| Compound Name | hexanoic acid;1-(methylamino)ethanol |
| PubChem CID | 173051508 |
| Molecular Formula | C9H21NO3 |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.15 |
| IUPAC Name | hexanoic acid;1-(methylamino)ethanol |
| SMILES | CCCCCC(=O)O.CNC(C)O |
| InChI | InChI=1S/C6H12O2.C3H9NO/c1-2-3-4-5-6(7)8;1-3(5)4-2/h2-5H2,1H3,(H,7,8);3-5H,1-2H3 |
| InChIKey | VAXNMDGPJGSOKZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze hexanoic acid;1-(methylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanoic acid;1-(methylamino)ethanol?
The IUPAC name of hexanoic acid;1-(methylamino)ethanol (CID 173051508) is hexanoic acid;1-(methylamino)ethanol.
What is the SMILES notation for hexanoic acid;1-(methylamino)ethanol?
The canonical SMILES for hexanoic acid;1-(methylamino)ethanol is CCCCCC(=O)O.CNC(C)O.
What is the InChIKey of hexanoic acid;1-(methylamino)ethanol?
The InChIKey is VAXNMDGPJGSOKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C3H9NO/c1-2-3-4-5-6(7)8;1-3(5)4-2/h2-5H2,1H3,(H,7,8);3-5H,1-2H3.
What are the key properties of hexanoic acid;1-(methylamino)ethanol?
hexanoic acid;1-(methylamino)ethanol has a molecular weight of 191.27 g/mol, XLogP of 1.20, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexanoic acid;1-(methylamino)ethanol is sourced from PubChem (CID 173051508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).