About 1-[bis(1-hydroxyethyl)amino]ethanol;tetradecanoic acid
1-[bis(1-hydroxyethyl)amino]ethanol;tetradecanoic acid (PubChem CID 87531971) has the molecular formula C20H43NO5
and a molecular weight of 377.57 g/mol. Its IUPAC name is 1-[bis(1-hydroxyethyl)amino]ethanol;tetradecanoic acid.
Molecular Properties
| Compound Name | 1-[bis(1-hydroxyethyl)amino]ethanol;tetradecanoic acid |
| PubChem CID | 87531971 |
| Molecular Formula | C20H43NO5 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.31 |
| IUPAC Name | 1-[bis(1-hydroxyethyl)amino]ethanol;tetradecanoic acid |
| SMILES | CC(O)N(C(C)O)C(C)O.CCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C14H28O2.C6H15NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-4(8)7(5(2)9)6(3)10/h2-13H2,1H3,(H,15,16);4-6,8-10H,1-3H3 |
| InChIKey | XYSYDDZMHDUKGZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[bis(1-hydroxyethyl)amino]ethanol;tetradecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bis(1-hydroxyethyl)amino]ethanol;tetradecanoic acid?
The IUPAC name of 1-[bis(1-hydroxyethyl)amino]ethanol;tetradecanoic acid (CID 87531971) is 1-[bis(1-hydroxyethyl)amino]ethanol;tetradecanoic acid.
What is the SMILES notation for 1-[bis(1-hydroxyethyl)amino]ethanol;tetradecanoic acid?
The canonical SMILES for 1-[bis(1-hydroxyethyl)amino]ethanol;tetradecanoic acid is CC(O)N(C(C)O)C(C)O.CCCCCCCCCCCCCC(=O)O.
What is the InChIKey of 1-[bis(1-hydroxyethyl)amino]ethanol;tetradecanoic acid?
The InChIKey is XYSYDDZMHDUKGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2.C6H15NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-4(8)7(5(2)9)6(3)10/h2-13H2,1H3,(H,15,16);4-6,8-10H,1-3H3.
What are the key properties of 1-[bis(1-hydroxyethyl)amino]ethanol;tetradecanoic acid?
1-[bis(1-hydroxyethyl)amino]ethanol;tetradecanoic acid has a molecular weight of 377.57 g/mol, XLogP of 4.08, 15 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bis(1-hydroxyethyl)amino]ethanol;tetradecanoic acid is sourced from PubChem (CID 87531971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).