C22H46N2O6 — CID 87532133
1-[bis(1-hydroxyethyl)amino]ethanol;2-(tetradecanoylamino)acetic acid (PubChem CID 87532133) has the molecular formula C22H46N2O6 and a molecular weight of 434.62 g/mol. Its IUPAC name is 1-[bis(1-hydroxyethyl)amino]ethanol;2-(tetradecanoylamino)acetic acid.
| Compound Name | 1-[bis(1-hydroxyethyl)amino]ethanol;2-(tetradecanoylamino)acetic acid |
|---|---|
| PubChem CID | 87532133 |
| Molecular Formula | C22H46N2O6 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | 1-[bis(1-hydroxyethyl)amino]ethanol;2-(tetradecanoylamino)acetic acid |
| SMILES | CC(O)N(C(C)O)C(C)O.CCCCCCCCCCCCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C16H31NO3.C6H15NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-15(18)17-14-16(19)20;1-4(8)7(5(2)9)6(3)10/h2-14H2,1H3,(H,17,18)(H,19,20);4-6,8-10H,1-3H3 |
| InChIKey | KBYGIQAUWIJAHJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|