C6H12N2 — CID 137396270
(1Z)-3-methylpenta-1,3-diene-1,5-diamine (PubChem CID 137396270) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is (1Z)-3-methylpenta-1,3-diene-1,5-diamine.
| Compound Name | (1Z)-3-methylpenta-1,3-diene-1,5-diamine |
|---|---|
| PubChem CID | 137396270 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | (1Z)-3-methylpenta-1,3-diene-1,5-diamine |
| SMILES | CC(=CCN)/C=C\N |
| InChI | InChI=1S/C6H12N2/c1-6(2-4-7)3-5-8/h2-4H,5,7-8H2,1H3/b4-2-,6-3? |
| InChIKey | GGFGCPHBWGVCIT-KVWLHZCQSA-N |
| XLogP | 0.36 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|