About (E)-4-aminobut-2-en-2-ol
(E)-4-aminobut-2-en-2-ol (PubChem CID 163890736) has the molecular formula C4H9NO
and a molecular weight of 87.12 g/mol. Its IUPAC name is (E)-4-aminobut-2-en-2-ol.
Molecular Properties
| Compound Name | (E)-4-aminobut-2-en-2-ol |
| PubChem CID | 163890736 |
| Molecular Formula | C4H9NO |
| Molecular Weight | 87.12 g/mol |
| Exact Mass | 87.07 |
| IUPAC Name | (E)-4-aminobut-2-en-2-ol |
| SMILES | C/C(O)=C\CN |
| InChI | InChI=1S/C4H9NO/c1-4(6)2-3-5/h2,6H,3,5H2,1H3/b4-2+ |
| InChIKey | CTTZQHOIFRRGGP-DUXPYHPUSA-N |
| XLogP | 0.41 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 87.12 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-aminobut-2-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-aminobut-2-en-2-ol?
The IUPAC name of (E)-4-aminobut-2-en-2-ol (CID 163890736) is (E)-4-aminobut-2-en-2-ol.
What is the SMILES notation for (E)-4-aminobut-2-en-2-ol?
The canonical SMILES for (E)-4-aminobut-2-en-2-ol is C/C(O)=C\CN.
What is the InChIKey of (E)-4-aminobut-2-en-2-ol?
The InChIKey is CTTZQHOIFRRGGP-DUXPYHPUSA-N. The full InChI is InChI=1S/C4H9NO/c1-4(6)2-3-5/h2,6H,3,5H2,1H3/b4-2+.
What are the key properties of (E)-4-aminobut-2-en-2-ol?
(E)-4-aminobut-2-en-2-ol has a molecular weight of 87.12 g/mol, XLogP of 0.41, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-aminobut-2-en-2-ol is sourced from PubChem (CID 163890736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).