C9H15N — CID 130224549
(1Z,3Z)-3,6-dimethylhepta-1,3,5-trien-1-amine (PubChem CID 130224549) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is (1Z,3Z)-3,6-dimethylhepta-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-3,6-dimethylhepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 130224549 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | (1Z,3Z)-3,6-dimethylhepta-1,3,5-trien-1-amine |
| SMILES | CC(C)=C/C=C(C)\C=C/N |
| InChI | InChI=1S/C9H15N/c1-8(2)4-5-9(3)6-7-10/h4-7H,10H2,1-3H3/b7-6-,9-5- |
| InChIKey | LMBGHNBCCUGOQH-LKDPLPNCSA-N |
| XLogP | 2.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|