C15H25NO3 — CID 123219816
(5-methoxy-2-methylidenehepta-3,5-dienyl) N-(1-hydroxy-2-methylpropan-2-yl)ethanimidate (PubChem CID 123219816) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is (5-methoxy-2-methylidenehepta-3,5-dienyl) N-(1-hydroxy-2-methylpropan-2-yl)ethanimidate.
| Compound Name | (5-methoxy-2-methylidenehepta-3,5-dienyl) N-(1-hydroxy-2-methylpropan-2-yl)ethanimidate |
|---|---|
| PubChem CID | 123219816 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (5-methoxy-2-methylidenehepta-3,5-dienyl) N-(1-hydroxy-2-methylpropan-2-yl)ethanimidate |
| SMILES | C=C(C=CC(=CC)OC)CO/C(C)=N/C(C)(C)CO |
| InChI | InChI=1S/C15H25NO3/c1-7-14(18-6)9-8-12(2)10-19-13(3)16-15(4,5)11-17/h7-9,17H,2,10-11H2,1,3-6H3/b9-8?,14-7?,16-13+ |
| InChIKey | BFCDIYLJFIMLNK-QJUOJGSYSA-N |
| XLogP | 2.85 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|