C13H26OSi — CID 11229887
tert-butyl-dimethyl-[(E)-2-methylidenehex-3-enoxy]silane (PubChem CID 11229887) has the molecular formula C13H26OSi and a molecular weight of 226.44 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E)-2-methylidenehex-3-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E)-2-methylidenehex-3-enoxy]silane |
|---|---|
| PubChem CID | 11229887 |
| Molecular Formula | C13H26OSi |
| Molecular Weight | 226.44 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | tert-butyl-dimethyl-[(E)-2-methylidenehex-3-enoxy]silane |
| SMILES | C=C(/C=C/CC)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H26OSi/c1-8-9-10-12(2)11-14-15(6,7)13(3,4)5/h9-10H,2,8,11H2,1,3-7H3/b10-9+ |
| InChIKey | IKRJBNUILKCTDE-MDZDMXLPSA-N |
| XLogP | 4.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|