C17H30N2OSi — CID 11358695
2-[(5E)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]octa-5,7-dienyl]iminoacetonitrile (PubChem CID 11358695) has the molecular formula C17H30N2OSi and a molecular weight of 306.53 g/mol. Its IUPAC name is 2-[(5E)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]octa-5,7-dienyl]iminoacetonitrile.
| Compound Name | 2-[(5E)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]octa-5,7-dienyl]iminoacetonitrile |
|---|---|
| PubChem CID | 11358695 |
| Molecular Formula | C17H30N2OSi |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 2-[(5E)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]octa-5,7-dienyl]iminoacetonitrile |
| SMILES | C=C(/C=C/CCCC/N=C/C#N)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H30N2OSi/c1-16(15-20-21(5,6)17(2,3)4)11-9-7-8-10-13-19-14-12-18/h9,11,14H,1,7-8,10,13,15H2,2-6H3/b11-9+,19-14+ |
| InChIKey | HIISCIUAVXJHPM-AFYXKLSTSA-N |
| XLogP | 4.89 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|