C24H44N2O2S2Si2 — CID 10255865
3-[(2Z,4Z)-1,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2-cyanoethylsulfanyl)hexa-2,4-dien-2-yl]sulfanylpropanenitrile (PubChem CID 10255865) has the molecular formula C24H44N2O2S2Si2 and a molecular weight of 512.93 g/mol. Its IUPAC name is 3-[(2Z,4Z)-1,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2-cyanoethylsulfanyl)hexa-2,4-dien-2-yl]sulfanylpropanenitrile.
| Compound Name | 3-[(2Z,4Z)-1,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2-cyanoethylsulfanyl)hexa-2,4-dien-2-yl]sulfanylpropanenitrile |
|---|---|
| PubChem CID | 10255865 |
| Molecular Formula | C24H44N2O2S2Si2 |
| Molecular Weight | 512.93 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | 3-[(2Z,4Z)-1,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2-cyanoethylsulfanyl)hexa-2,4-dien-2-yl]sulfanylpropanenitrile |
| SMILES | CC(C)(C)[Si](C)(C)OC/C(=C/C=C(/CO[Si](C)(C)C(C)(C)C)SCCC#N)SCCC#N |
| InChI | InChI=1S/C24H44N2O2S2Si2/c1-23(2,3)31(7,8)27-19-21(29-17-11-15-25)13-14-22(30-18-12-16-26)20-28-32(9,10)24(4,5)6/h13-14H,11-12,17-20H2,1-10H3/b21-13-,22-14- |
| InChIKey | FKASVNTVRZWFEN-JZTLMNBPSA-N |
| XLogP | 8.09 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.93 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|