C18H30N2O2S2Si — CID 10023823
3-[(2Z,4Z)-6-[tert-butyl(dimethyl)silyl]oxy-5-(2-cyanoethylsulfanyl)-1-hydroxyhexa-2,4-dien-2-yl]sulfanylpropanenitrile (PubChem CID 10023823) has the molecular formula C18H30N2O2S2Si and a molecular weight of 398.67 g/mol. Its IUPAC name is 3-[(2Z,4Z)-6-[tert-butyl(dimethyl)silyl]oxy-5-(2-cyanoethylsulfanyl)-1-hydroxyhexa-2,4-dien-2-yl]sulfanylpropanenitrile.
| Compound Name | 3-[(2Z,4Z)-6-[tert-butyl(dimethyl)silyl]oxy-5-(2-cyanoethylsulfanyl)-1-hydroxyhexa-2,4-dien-2-yl]sulfanylpropanenitrile |
|---|---|
| PubChem CID | 10023823 |
| Molecular Formula | C18H30N2O2S2Si |
| Molecular Weight | 398.67 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 3-[(2Z,4Z)-6-[tert-butyl(dimethyl)silyl]oxy-5-(2-cyanoethylsulfanyl)-1-hydroxyhexa-2,4-dien-2-yl]sulfanylpropanenitrile |
| SMILES | CC(C)(C)[Si](C)(C)OC/C(=C/C=C(/CO)SCCC#N)SCCC#N |
| InChI | InChI=1S/C18H30N2O2S2Si/c1-18(2,3)25(4,5)22-15-17(24-13-7-11-20)9-8-16(14-21)23-12-6-10-19/h8-9,21H,6-7,12-15H2,1-5H3/b16-8-,17-9- |
| InChIKey | ZPLALPGNJIPMTH-JCDHFMOQSA-N |
| XLogP | 5.06 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.67 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|