C14H28O2Si — CID 135040202
(4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]hepta-1,6-dien-4-ol (PubChem CID 135040202) has the molecular formula C14H28O2Si and a molecular weight of 256.46 g/mol. Its IUPAC name is (4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]hepta-1,6-dien-4-ol.
| Compound Name | (4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]hepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 135040202 |
| Molecular Formula | C14H28O2Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]hepta-1,6-dien-4-ol |
| SMILES | C=CC[C@H](O)CC(=C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28O2Si/c1-8-9-13(15)10-12(2)11-16-17(6,7)14(3,4)5/h8,13,15H,1-2,9-11H2,3-7H3/t13-/m0/s1 |
| InChIKey | MYTLLBXWOBOOOB-ZDUSSCGKSA-N |
| XLogP | 3.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|