C12H19O- — CID 90782032
(2E,4Z)-3-ethoxy-6-methylidenenona-2,4-diene (PubChem CID 90782032) has the molecular formula C12H19O- and a molecular weight of 179.28 g/mol. Its IUPAC name is (2E,4Z)-3-ethoxy-6-methylidenenona-2,4-diene.
| Compound Name | (2E,4Z)-3-ethoxy-6-methylidenenona-2,4-diene |
|---|---|
| PubChem CID | 90782032 |
| Molecular Formula | C12H19O- |
| Molecular Weight | 179.28 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | (2E,4Z)-3-ethoxy-6-methylidenenona-2,4-diene |
| SMILES | C=C(/C=C\C(=C/C)OCC)C[CH-]C |
| InChI | InChI=1S/C12H19O/c1-5-8-11(4)9-10-12(6-2)13-7-3/h5-6,9-10H,4,7-8H2,1-3H3/q-1/b10-9-,12-6+ |
| InChIKey | NUQZIXNANVFVKJ-MTBRRYQKSA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|