C15H17Cl2NO3 — CID 143088133
cyanomethyl 2,2-dichloro-1-[(3Z,5E)-5-ethoxyhepta-1,3,5-trien-2-yl]cyclopropane-1-carboxylate (PubChem CID 143088133) has the molecular formula C15H17Cl2NO3 and a molecular weight of 330.21 g/mol. Its IUPAC name is cyanomethyl 2,2-dichloro-1-[(3Z,5E)-5-ethoxyhepta-1,3,5-trien-2-yl]cyclopropane-1-carboxylate.
| Compound Name | cyanomethyl 2,2-dichloro-1-[(3Z,5E)-5-ethoxyhepta-1,3,5-trien-2-yl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 143088133 |
| Molecular Formula | C15H17Cl2NO3 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | cyanomethyl 2,2-dichloro-1-[(3Z,5E)-5-ethoxyhepta-1,3,5-trien-2-yl]cyclopropane-1-carboxylate |
| SMILES | C=C(/C=C\C(=C/C)OCC)C1(C(=O)OCC#N)CC1(Cl)Cl |
| InChI | InChI=1S/C15H17Cl2NO3/c1-4-12(20-5-2)7-6-11(3)14(10-15(14,16)17)13(19)21-9-8-18/h4,6-7H,3,5,9-10H2,1-2H3/b7-6-,12-4+ |
| InChIKey | BPOKHOAHMDDMLJ-WLWVQNKQSA-N |
| XLogP | 3.67 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|