C12H21NO — CID 129028276
(3Z,5E,7Z)-6-methoxy-2,2-dimethylnona-3,5,7-trien-3-amine (PubChem CID 129028276) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (3Z,5E,7Z)-6-methoxy-2,2-dimethylnona-3,5,7-trien-3-amine.
| Compound Name | (3Z,5E,7Z)-6-methoxy-2,2-dimethylnona-3,5,7-trien-3-amine |
|---|---|
| PubChem CID | 129028276 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (3Z,5E,7Z)-6-methoxy-2,2-dimethylnona-3,5,7-trien-3-amine |
| SMILES | C/C=C\C(=C/C=C(\N)C(C)(C)C)OC |
| InChI | InChI=1S/C12H21NO/c1-6-7-10(14-5)8-9-11(13)12(2,3)4/h6-9H,13H2,1-5H3/b7-6-,10-8+,11-9- |
| InChIKey | SELRUQXNMGFRGP-YXLBRCCFSA-N |
| XLogP | 2.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|