C28H25F3O3 — CID 143909366
4-[2,3-difluoro-4-[4-[[(3E)-3-fluoro-5-methoxyhexa-1,3,5-trien-2-yl]oxymethyl]phenyl]phenyl]phenol;ethene (PubChem CID 143909366) has the molecular formula C28H25F3O3 and a molecular weight of 466.50 g/mol. Its IUPAC name is 4-[2,3-difluoro-4-[4-[[(3E)-3-fluoro-5-methoxyhexa-1,3,5-trien-2-yl]oxymethyl]phenyl]phenyl]phenol;ethene.
| Compound Name | 4-[2,3-difluoro-4-[4-[[(3E)-3-fluoro-5-methoxyhexa-1,3,5-trien-2-yl]oxymethyl]phenyl]phenyl]phenol;ethene |
|---|---|
| PubChem CID | 143909366 |
| Molecular Formula | C28H25F3O3 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 4-[2,3-difluoro-4-[4-[[(3E)-3-fluoro-5-methoxyhexa-1,3,5-trien-2-yl]oxymethyl]phenyl]phenyl]phenol;ethene |
| SMILES | C=C.C=C(/C=C(/F)C(=C)OCc1ccc(-c2ccc(-c3ccc(O)cc3)c(F)c2F)cc1)OC |
| InChI | InChI=1S/C26H21F3O3.C2H4/c1-16(31-3)14-24(27)17(2)32-15-18-4-6-19(7-5-18)22-12-13-23(26(29)25(22)28)20-8-10-21(30)11-9-20;1-2/h4-14,30H,1-2,15H2,3H3;1-2H2/b24-14+; |
| InChIKey | VCFHIJKQENDIKY-SXMBIPSUSA-N |
| XLogP | 7.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|